C16H25BN2O4S — CID 142434290
N-[2-(1,3,2,4-dioxathiaboretan-4-ylmethylamino)-2-oxoethyl]-2,5-dimethylbenzamide;2-methylpropane (PubChem CID 142434290) has the molecular formula C16H25BN2O4S and a molecular weight of 352.27 g/mol. Its IUPAC name is N-[2-(1,3,2,4-dioxathiaboretan-4-ylmethylamino)-2-oxoethyl]-2,5-dimethylbenzamide;2-methylpropane.
| Compound Name | N-[2-(1,3,2,4-dioxathiaboretan-4-ylmethylamino)-2-oxoethyl]-2,5-dimethylbenzamide;2-methylpropane |
|---|---|
| PubChem CID | 142434290 |
| Molecular Formula | C16H25BN2O4S |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-[2-(1,3,2,4-dioxathiaboretan-4-ylmethylamino)-2-oxoethyl]-2,5-dimethylbenzamide;2-methylpropane |
| SMILES | CC(C)C.Cc1ccc(C)c(C(=O)NCC(=O)NCB2OSO2)c1 |
| InChI | InChI=1S/C12H15BN2O4S.C4H10/c1-8-3-4-9(2)10(5-8)12(17)14-6-11(16)15-7-13-18-20-19-13;1-4(2)3/h3-5H,6-7H2,1-2H3,(H,14,17)(H,15,16);4H,1-3H3 |
| InChIKey | JZMNWGXVLUDBGE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|