C6H11N3O2S — CID 142434786
3-(2-methoxyethoxymethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 142434786) has the molecular formula C6H11N3O2S and a molecular weight of 189.24 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(2-methoxyethoxymethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 142434786 |
| Molecular Formula | C6H11N3O2S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | COCCOCc1nsc(N)n1 |
| InChI | InChI=1S/C6H11N3O2S/c1-10-2-3-11-4-5-8-6(7)12-9-5/h2-4H2,1H3,(H2,7,8,9) |
| InChIKey | TTWGQFOZGZDVKY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|