C6H10N2OS — CID 135170708
3-(ethoxymethyl)-5-methyl-1,2,4-thiadiazole (PubChem CID 135170708) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is 3-(ethoxymethyl)-5-methyl-1,2,4-thiadiazole.
| Compound Name | 3-(ethoxymethyl)-5-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 135170708 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 3-(ethoxymethyl)-5-methyl-1,2,4-thiadiazole |
| SMILES | CCOCc1nsc(C)n1 |
| InChI | InChI=1S/C6H10N2OS/c1-3-9-4-6-7-5(2)10-8-6/h3-4H2,1-2H3 |
| InChIKey | OOIJUAYBDODNAZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |