C17H28O3 — CID 142437407
ethane;(4E)-4-propylidene-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid (PubChem CID 142437407) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is ethane;(4E)-4-propylidene-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid.
| Compound Name | ethane;(4E)-4-propylidene-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid |
|---|---|
| PubChem CID | 142437407 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | ethane;(4E)-4-propylidene-10-oxatricyclo[7.2.1.01,5]dodecane-8-carboxylic acid |
| SMILES | CC.CC/C=C1\CCC23COC(C2)C(C(=O)O)CCC13 |
| InChI | InChI=1S/C15H22O3.C2H6/c1-2-3-10-6-7-15-8-13(18-9-15)11(14(16)17)4-5-12(10)15;1-2/h3,11-13H,2,4-9H2,1H3,(H,16,17);1-2H3/b10-3+; |
| InChIKey | LRYVXEZMIUJPGK-ORVWSRSGSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|