C10H14N2O4 — CID 142438422
N-(1-formylcyclobutyl)-4-hydroxy-2-oxopyrrolidine-3-carboxamide (PubChem CID 142438422) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is N-(1-formylcyclobutyl)-4-hydroxy-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(1-formylcyclobutyl)-4-hydroxy-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 142438422 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N-(1-formylcyclobutyl)-4-hydroxy-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=CC1(NC(=O)C2C(=O)NCC2O)CCC1 |
| InChI | InChI=1S/C10H14N2O4/c13-5-10(2-1-3-10)12-9(16)7-6(14)4-11-8(7)15/h5-7,14H,1-4H2,(H,11,15)(H,12,16) |
| InChIKey | PPSAREJNSGEDTL-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|