C54H47BN4O2 — CID 142438918
1-cyclohexa-1,5-dien-1-yl-2-[4-[2-[3-[2-[4-(1-phenylimidazol-2-yl)phenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]imidazole (PubChem CID 142438918) has the molecular formula C54H47BN4O2 and a molecular weight of 794.81 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-[4-[2-[3-[2-[4-(1-phenylimidazol-2-yl)phenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]imidazole.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-[4-[2-[3-[2-[4-(1-phenylimidazol-2-yl)phenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]imidazole |
|---|---|
| PubChem CID | 142438918 |
| Molecular Formula | C54H47BN4O2 |
| Molecular Weight | 794.81 g/mol |
| Exact Mass | 794.38 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-[4-[2-[3-[2-[4-(1-phenylimidazol-2-yl)phenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]imidazole |
| SMILES | CC1(C)OB(c2cc(-c3ccccc3-c3ccc(-c4nccn4C4=CCCC=C4)cc3)cc(-c3ccccc3-c3ccc(-c4nccn4-c4ccccc4)cc3)c2)OC1(C)C |
| InChI | InChI=1S/C54H47BN4O2/c1-53(2)54(3,4)61-55(60-53)44-36-42(49-21-13-11-19-47(49)38-23-27-40(28-24-38)51-56-31-33-58(51)45-15-7-5-8-16-45)35-43(37-44)50-22-14-12-20-48(50)39-25-29-41(30-26-39)52-57-32-34-59(52)46-17-9-6-10-18-46/h5,7-9,11-37H,6,10H2,1-4H3 |
| InChIKey | ZFHPYPAUYWBLOH-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.81 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|