C58H49BN2O2 — CID 142438965
4-cyclohexa-1,5-dien-1-yl-5-[2-[3-[2-(4,6-diphenyl-3-pyridinyl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-phenylpyridine (PubChem CID 142438965) has the molecular formula C58H49BN2O2 and a molecular weight of 816.85 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-5-[2-[3-[2-(4,6-diphenyl-3-pyridinyl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-phenylpyridine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-5-[2-[3-[2-(4,6-diphenyl-3-pyridinyl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-phenylpyridine |
|---|---|
| PubChem CID | 142438965 |
| Molecular Formula | C58H49BN2O2 |
| Molecular Weight | 816.85 g/mol |
| Exact Mass | 816.39 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-5-[2-[3-[2-(4,6-diphenyl-3-pyridinyl)phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-2-phenylpyridine |
| SMILES | CC1(C)OB(c2cc(-c3ccccc3-c3cnc(-c4ccccc4)cc3C3=CCCC=C3)cc(-c3ccccc3-c3cnc(-c4ccccc4)cc3-c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C58H49BN2O2/c1-57(2)58(3,4)63-59(62-57)46-34-44(47-29-17-19-31-49(47)53-38-60-55(42-25-13-7-14-26-42)36-51(53)40-21-9-5-10-22-40)33-45(35-46)48-30-18-20-32-50(48)54-39-61-56(43-27-15-8-16-28-43)37-52(54)41-23-11-6-12-24-41/h5,7-11,13-39H,6,12H2,1-4H3 |
| InChIKey | NVHKHUGNOBXBRW-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.85 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|