C48H56B2F3N3O2 — CID 139051573
(E)-N'-bis(2,4,6-trimethylphenyl)boranyl-N,N'-bis(2,6-dimethylphenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethene-1,2-diamine (PubChem CID 139051573) has the molecular formula C48H56B2F3N3O2 and a molecular weight of 785.61 g/mol. Its IUPAC name is (E)-N'-bis(2,4,6-trimethylphenyl)boranyl-N,N'-bis(2,6-dimethylphenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethene-1,2-diamine.
| Compound Name | (E)-N'-bis(2,4,6-trimethylphenyl)boranyl-N,N'-bis(2,6-dimethylphenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 139051573 |
| Molecular Formula | C48H56B2F3N3O2 |
| Molecular Weight | 785.61 g/mol |
| Exact Mass | 785.45 |
| IUPAC Name | (E)-N'-bis(2,4,6-trimethylphenyl)boranyl-N,N'-bis(2,6-dimethylphenyl)-N-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethene-1,2-diamine |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)N(/C=C(\c2ccc(C(F)(F)F)cn2)N(B2OC(C)(C)C(C)(C)O2)c2c(C)cccc2C)c2c(C)cccc2C)c(C)c1 |
| InChI | InChI=1S/C48H56B2F3N3O2/c1-29-23-35(7)42(36(8)24-29)49(43-37(9)25-30(2)26-38(43)10)55(44-31(3)17-15-18-32(44)4)28-41(40-22-21-39(27-54-40)48(51,52)53)56(45-33(5)19-16-20-34(45)6)50-57-46(11,12)47(13,14)58-50/h15-28H,1-14H3/b41-28+ |
| InChIKey | HWRUVNYHRMCTEJ-SISPBFPDSA-N |
| XLogP | 10.89 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.61 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|