C21H26N2O2 — CID 142442818
N-(2-amino-1-cyclohexyl-2-oxoethyl)-3-naphthalen-2-ylpropanamide (PubChem CID 142442818) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexyl-2-oxoethyl)-3-naphthalen-2-ylpropanamide.
| Compound Name | N-(2-amino-1-cyclohexyl-2-oxoethyl)-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 142442818 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-(2-amino-1-cyclohexyl-2-oxoethyl)-3-naphthalen-2-ylpropanamide |
| SMILES | NC(=O)C(NC(=O)CCc1ccc2ccccc2c1)C1CCCCC1 |
| InChI | InChI=1S/C21H26N2O2/c22-21(25)20(17-7-2-1-3-8-17)23-19(24)13-11-15-10-12-16-6-4-5-9-18(16)14-15/h4-6,9-10,12,14,17,20H,1-3,7-8,11,13H2,(H2,22,25)(H,23,24) |
| InChIKey | XZMGTEDELBZBJW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |