C25H30N2O4 — CID 131968881
N-[1-cyclohexyl-2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(3,4-dihydroxyphenyl)propanamide (PubChem CID 131968881) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(3,4-dihydroxyphenyl)propanamide.
| Compound Name | N-[1-cyclohexyl-2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(3,4-dihydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 131968881 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[1-cyclohexyl-2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-3-(3,4-dihydroxyphenyl)propanamide |
| SMILES | O=C(CCc1ccc(O)c(O)c1)NC(C(=O)N1CCc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C25H30N2O4/c28-21-12-10-17(16-22(21)29)11-13-23(30)26-24(19-7-2-1-3-8-19)25(31)27-15-14-18-6-4-5-9-20(18)27/h4-6,9-10,12,16,19,24,28-29H,1-3,7-8,11,13-15H2,(H,26,30) |
| InChIKey | CTKBAPUQCPUICU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|