C35H45ClN2O5S — CID 142443583
(2S)-2-[(8E)-22-(4-chloro-2-propylphenyl)-7-hydroxy-11,12-dimethyl-13,15-dioxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-7-yl]propanal (PubChem CID 142443583) has the molecular formula C35H45ClN2O5S and a molecular weight of 641.27 g/mol. Its IUPAC name is (2S)-2-[(8E)-22-(4-chloro-2-propylphenyl)-7-hydroxy-11,12-dimethyl-13,15-dioxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-7-yl]propanal.
| Compound Name | (2S)-2-[(8E)-22-(4-chloro-2-propylphenyl)-7-hydroxy-11,12-dimethyl-13,15-dioxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-7-yl]propanal |
|---|---|
| PubChem CID | 142443583 |
| Molecular Formula | C35H45ClN2O5S |
| Molecular Weight | 641.27 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | (2S)-2-[(8E)-22-(4-chloro-2-propylphenyl)-7-hydroxy-11,12-dimethyl-13,15-dioxo-20-oxa-13λ4-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-8,16(25),17,19(24)-tetraen-7-yl]propanal |
| SMILES | CCCc1cc(Cl)ccc1C1COc2ccc3cc2N(C1)CC1CCC1C(O)(C(C)C=O)/C=C/CC(C)C(C)S(=O)NC3=O |
| InChI | InChI=1S/C35H45ClN2O5S/c1-5-7-25-16-29(36)11-12-30(25)28-19-38-18-27-9-13-31(27)35(41,23(3)20-39)15-6-8-22(2)24(4)44(42)37-34(40)26-10-14-33(43-21-28)32(38)17-26/h6,10-12,14-17,20,22-24,27-28,31,41H,5,7-9,13,18-19,21H2,1-4H3,(H,37,40)/b15-6+ |
| InChIKey | DRINDELFDFGTNF-GIDUJCDVSA-N |
| XLogP | 6.25 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.27 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|