C11H24N2O2 — CID 142443734
1-(1,3-dimethoxypropan-2-yl)-4-ethylpiperazine (PubChem CID 142443734) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(1,3-dimethoxypropan-2-yl)-4-ethylpiperazine.
| Compound Name | 1-(1,3-dimethoxypropan-2-yl)-4-ethylpiperazine |
|---|---|
| PubChem CID | 142443734 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 1-(1,3-dimethoxypropan-2-yl)-4-ethylpiperazine |
| SMILES | CCN1CCN(C(COC)COC)CC1 |
| InChI | InChI=1S/C11H24N2O2/c1-4-12-5-7-13(8-6-12)11(9-14-2)10-15-3/h11H,4-10H2,1-3H3 |
| InChIKey | NNPYSWYLTLDARN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |