C25H37N3O5 — CID 142446210
tert-butyl N-methyl-N-[[4-[4-(4-nitrophenyl)piperidine-1-carbonyl]cyclohexyl]methyl]carbamate (PubChem CID 142446210) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[[4-[4-(4-nitrophenyl)piperidine-1-carbonyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[[4-[4-(4-nitrophenyl)piperidine-1-carbonyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 142446210 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | tert-butyl N-methyl-N-[[4-[4-(4-nitrophenyl)piperidine-1-carbonyl]cyclohexyl]methyl]carbamate |
| SMILES | CN(CC1CCC(C(=O)N2CCC(c3ccc([N+](=O)[O-])cc3)CC2)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H37N3O5/c1-25(2,3)33-24(30)26(4)17-18-5-7-21(8-6-18)23(29)27-15-13-20(14-16-27)19-9-11-22(12-10-19)28(31)32/h9-12,18,20-21H,5-8,13-17H2,1-4H3 |
| InChIKey | LBTHVAGDLFHYFK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|