C26H38N2O3 — CID 142446255
tert-butyl (Z)-2-[[4-(4-pyridin-3-ylpiperidine-1-carbonyl)cyclohexyl]methyl]but-2-enoate (PubChem CID 142446255) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is tert-butyl (Z)-2-[[4-(4-pyridin-3-ylpiperidine-1-carbonyl)cyclohexyl]methyl]but-2-enoate.
| Compound Name | tert-butyl (Z)-2-[[4-(4-pyridin-3-ylpiperidine-1-carbonyl)cyclohexyl]methyl]but-2-enoate |
|---|---|
| PubChem CID | 142446255 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | tert-butyl (Z)-2-[[4-(4-pyridin-3-ylpiperidine-1-carbonyl)cyclohexyl]methyl]but-2-enoate |
| SMILES | C/C=C(/CC1CCC(C(=O)N2CCC(c3cccnc3)CC2)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N2O3/c1-5-20(25(30)31-26(2,3)4)17-19-8-10-22(11-9-19)24(29)28-15-12-21(13-16-28)23-7-6-14-27-18-23/h5-7,14,18-19,21-22H,8-13,15-17H2,1-4H3/b20-5- |
| InChIKey | LRGFPZOYZPRSAQ-SDPNRITHSA-N |
| XLogP | 5.27 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|