C14H13Cl2N3O5 — CID 142446435
(3,4-dichlorophenyl)methyl N-[2-[3-(hydroxycarbamoyl)-1,2-oxazol-5-yl]ethyl]carbamate (PubChem CID 142446435) has the molecular formula C14H13Cl2N3O5 and a molecular weight of 374.18 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl N-[2-[3-(hydroxycarbamoyl)-1,2-oxazol-5-yl]ethyl]carbamate.
| Compound Name | (3,4-dichlorophenyl)methyl N-[2-[3-(hydroxycarbamoyl)-1,2-oxazol-5-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 142446435 |
| Molecular Formula | C14H13Cl2N3O5 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | (3,4-dichlorophenyl)methyl N-[2-[3-(hydroxycarbamoyl)-1,2-oxazol-5-yl]ethyl]carbamate |
| SMILES | O=C(NCCc1cc(C(=O)NO)no1)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N3O5/c15-10-2-1-8(5-11(10)16)7-23-14(21)17-4-3-9-6-12(19-24-9)13(20)18-22/h1-2,5-6,22H,3-4,7H2,(H,17,21)(H,18,20) |
| InChIKey | JTZUTBFFCLVGRT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|