C32H35F3N2O2S — CID 142451107
ethane;2-[4-[4-[[pyridin-3-ylmethyl-[4-(trifluoromethyl)phenyl]sulfanylamino]methyl]phenyl]phenyl]acetic acid (PubChem CID 142451107) has the molecular formula C32H35F3N2O2S and a molecular weight of 568.71 g/mol. Its IUPAC name is ethane;2-[4-[4-[[pyridin-3-ylmethyl-[4-(trifluoromethyl)phenyl]sulfanylamino]methyl]phenyl]phenyl]acetic acid.
| Compound Name | ethane;2-[4-[4-[[pyridin-3-ylmethyl-[4-(trifluoromethyl)phenyl]sulfanylamino]methyl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 142451107 |
| Molecular Formula | C32H35F3N2O2S |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | ethane;2-[4-[4-[[pyridin-3-ylmethyl-[4-(trifluoromethyl)phenyl]sulfanylamino]methyl]phenyl]phenyl]acetic acid |
| SMILES | CC.CC.O=C(O)Cc1ccc(-c2ccc(CN(Cc3cccnc3)Sc3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H23F3N2O2S.2C2H6/c29-28(30,31)25-11-13-26(14-12-25)36-33(19-22-2-1-15-32-17-22)18-21-5-9-24(10-6-21)23-7-3-20(4-8-23)16-27(34)35;2*1-2/h1-15,17H,16,18-19H2,(H,34,35);2*1-2H3 |
| InChIKey | RAMXHQXUEDTWOT-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|