C29H31BrCl3N3O3 — CID 142451423
5-[[6-bromo-2-(3-ethylpiperidin-1-yl)-3-methylquinoline-4-carbonyl]amino]-4-(2,3,6-trichlorophenyl)pentanoic acid (PubChem CID 142451423) has the molecular formula C29H31BrCl3N3O3 and a molecular weight of 655.85 g/mol. Its IUPAC name is 5-[[6-bromo-2-(3-ethylpiperidin-1-yl)-3-methylquinoline-4-carbonyl]amino]-4-(2,3,6-trichlorophenyl)pentanoic acid.
| Compound Name | 5-[[6-bromo-2-(3-ethylpiperidin-1-yl)-3-methylquinoline-4-carbonyl]amino]-4-(2,3,6-trichlorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 142451423 |
| Molecular Formula | C29H31BrCl3N3O3 |
| Molecular Weight | 655.85 g/mol |
| Exact Mass | 653.06 |
| IUPAC Name | 5-[[6-bromo-2-(3-ethylpiperidin-1-yl)-3-methylquinoline-4-carbonyl]amino]-4-(2,3,6-trichlorophenyl)pentanoic acid |
| SMILES | CCC1CCCN(c2nc3ccc(Br)cc3c(C(=O)NCC(CCC(=O)O)c3c(Cl)ccc(Cl)c3Cl)c2C)C1 |
| InChI | InChI=1S/C29H31BrCl3N3O3/c1-3-17-5-4-12-36(15-17)28-16(2)25(20-13-19(30)7-10-23(20)35-28)29(39)34-14-18(6-11-24(37)38)26-21(31)8-9-22(32)27(26)33/h7-10,13,17-18H,3-6,11-12,14-15H2,1-2H3,(H,34,39)(H,37,38) |
| InChIKey | RHQLMXROLJLQMT-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.85 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|