C28H29BrClF2N3O3 — CID 162677991
(4S)-5-[[2-(azepan-1-yl)-6-bromo-3-methylquinoline-4-carbonyl]amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid (PubChem CID 162677991) has the molecular formula C28H29BrClF2N3O3 and a molecular weight of 608.91 g/mol. Its IUPAC name is (4S)-5-[[2-(azepan-1-yl)-6-bromo-3-methylquinoline-4-carbonyl]amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid.
| Compound Name | (4S)-5-[[2-(azepan-1-yl)-6-bromo-3-methylquinoline-4-carbonyl]amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 162677991 |
| Molecular Formula | C28H29BrClF2N3O3 |
| Molecular Weight | 608.91 g/mol |
| Exact Mass | 607.10 |
| IUPAC Name | (4S)-5-[[2-(azepan-1-yl)-6-bromo-3-methylquinoline-4-carbonyl]amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid |
| SMILES | Cc1c(N2CCCCCC2)nc2ccc(Br)cc2c1C(=O)NC[C@@H](CCC(=O)O)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C28H29BrClF2N3O3/c1-16-24(19-14-18(29)7-10-22(19)34-27(16)35-12-4-2-3-5-13-35)28(38)33-15-17(6-11-23(36)37)25-20(31)8-9-21(32)26(25)30/h7-10,14,17H,2-6,11-13,15H2,1H3,(H,33,38)(H,36,37)/t17-/m1/s1 |
| InChIKey | WYXUEYCHPTUSCB-QGZVFWFLSA-N |
| XLogP | 7.00 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.91 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|