C28H29BrClF2N3O2 — CID 142451479
6-bromo-N-[2-(6-chloro-2,3-difluorophenyl)-5-oxohexyl]-3-methyl-2-piperidin-1-ylquinoline-4-carboxamide (PubChem CID 142451479) has the molecular formula C28H29BrClF2N3O2 and a molecular weight of 592.91 g/mol. Its IUPAC name is 6-bromo-N-[2-(6-chloro-2,3-difluorophenyl)-5-oxohexyl]-3-methyl-2-piperidin-1-ylquinoline-4-carboxamide.
| Compound Name | 6-bromo-N-[2-(6-chloro-2,3-difluorophenyl)-5-oxohexyl]-3-methyl-2-piperidin-1-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 142451479 |
| Molecular Formula | C28H29BrClF2N3O2 |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 6-bromo-N-[2-(6-chloro-2,3-difluorophenyl)-5-oxohexyl]-3-methyl-2-piperidin-1-ylquinoline-4-carboxamide |
| SMILES | CC(=O)CCC(CNC(=O)c1c(C)c(N2CCCCC2)nc2ccc(Br)cc12)c1c(Cl)ccc(F)c1F |
| InChI | InChI=1S/C28H29BrClF2N3O2/c1-16(36)6-7-18(25-21(30)9-10-22(31)26(25)32)15-33-28(37)24-17(2)27(35-12-4-3-5-13-35)34-23-11-8-19(29)14-20(23)24/h8-11,14,18H,3-7,12-13,15H2,1-2H3,(H,33,37) |
| InChIKey | IMWSDJQHQKTGKI-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|