C25H24BrCl2FN2O3 — CID 142451627
tert-butyl 4-[(6-bromo-2-chloro-3-methylquinoline-4-carbonyl)amino]-3-(2-chloro-6-fluorophenyl)butanoate (PubChem CID 142451627) has the molecular formula C25H24BrCl2FN2O3 and a molecular weight of 570.29 g/mol. Its IUPAC name is tert-butyl 4-[(6-bromo-2-chloro-3-methylquinoline-4-carbonyl)amino]-3-(2-chloro-6-fluorophenyl)butanoate.
| Compound Name | tert-butyl 4-[(6-bromo-2-chloro-3-methylquinoline-4-carbonyl)amino]-3-(2-chloro-6-fluorophenyl)butanoate |
|---|---|
| PubChem CID | 142451627 |
| Molecular Formula | C25H24BrCl2FN2O3 |
| Molecular Weight | 570.29 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | tert-butyl 4-[(6-bromo-2-chloro-3-methylquinoline-4-carbonyl)amino]-3-(2-chloro-6-fluorophenyl)butanoate |
| SMILES | Cc1c(Cl)nc2ccc(Br)cc2c1C(=O)NCC(CC(=O)OC(C)(C)C)c1c(F)cccc1Cl |
| InChI | InChI=1S/C25H24BrCl2FN2O3/c1-13-21(16-11-15(26)8-9-19(16)31-23(13)28)24(33)30-12-14(10-20(32)34-25(2,3)4)22-17(27)6-5-7-18(22)29/h5-9,11,14H,10,12H2,1-4H3,(H,30,33) |
| InChIKey | HJNDCNIPOXJPRC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.29 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|