C19H26O4S — CID 14245807
2,2-dimethyl-5-(1-phenylsulfanylheptyl)-1,3-dioxane-4,6-dione (PubChem CID 14245807) has the molecular formula C19H26O4S and a molecular weight of 350.48 g/mol. Its IUPAC name is 2,2-dimethyl-5-(1-phenylsulfanylheptyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(1-phenylsulfanylheptyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 14245807 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2,2-dimethyl-5-(1-phenylsulfanylheptyl)-1,3-dioxane-4,6-dione |
| SMILES | CCCCCCC(Sc1ccccc1)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C19H26O4S/c1-4-5-6-10-13-15(24-14-11-8-7-9-12-14)16-17(20)22-19(2,3)23-18(16)21/h7-9,11-12,15-16H,4-6,10,13H2,1-3H3 |
| InChIKey | MGBOQQSBMQHQNH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|