C19H18O4S — CID 14245808
2,2-dimethyl-5-[phenyl(phenylsulfanyl)methyl]-1,3-dioxane-4,6-dione (PubChem CID 14245808) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2,2-dimethyl-5-[phenyl(phenylsulfanyl)methyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[phenyl(phenylsulfanyl)methyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 14245808 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2,2-dimethyl-5-[phenyl(phenylsulfanyl)methyl]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C(Sc2ccccc2)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C19H18O4S/c1-19(2)22-17(20)15(18(21)23-19)16(13-9-5-3-6-10-13)24-14-11-7-4-8-12-14/h3-12,15-16H,1-2H3 |
| InChIKey | PUMWATGBQBLIGY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|