C12H16BNO2 — CID 142459248
[3-(cyclopentylcarbamoyl)phenyl]borinic acid (PubChem CID 142459248) has the molecular formula C12H16BNO2 and a molecular weight of 217.08 g/mol. Its IUPAC name is [3-(cyclopentylcarbamoyl)phenyl]borinic acid.
| Compound Name | [3-(cyclopentylcarbamoyl)phenyl]borinic acid |
|---|---|
| PubChem CID | 142459248 |
| Molecular Formula | C12H16BNO2 |
| Molecular Weight | 217.08 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | [3-(cyclopentylcarbamoyl)phenyl]borinic acid |
| SMILES | O=C(NC1CCCC1)c1cccc(BO)c1 |
| InChI | InChI=1S/C12H16BNO2/c15-12(14-11-6-1-2-7-11)9-4-3-5-10(8-9)13-16/h3-5,8,11,13,16H,1-2,6-7H2,(H,14,15) |
| InChIKey | HYUONFIOROCZRZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.08 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|