C34H45Cl2N3O4 — CID 157227536
benzene-1,3-dicarbonyl chloride;cyclohexanamine;1-N,3-N-dicyclohexylbenzene-1,3-dicarboxamide (PubChem CID 157227536) has the molecular formula C34H45Cl2N3O4 and a molecular weight of 630.66 g/mol. Its IUPAC name is benzene-1,3-dicarbonyl chloride;cyclohexanamine;1-N,3-N-dicyclohexylbenzene-1,3-dicarboxamide.
| Compound Name | benzene-1,3-dicarbonyl chloride;cyclohexanamine;1-N,3-N-dicyclohexylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 157227536 |
| Molecular Formula | C34H45Cl2N3O4 |
| Molecular Weight | 630.66 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | benzene-1,3-dicarbonyl chloride;cyclohexanamine;1-N,3-N-dicyclohexylbenzene-1,3-dicarboxamide |
| SMILES | NC1CCCCC1.O=C(Cl)c1cccc(C(=O)Cl)c1.O=C(NC1CCCCC1)c1cccc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C20H28N2O2.C8H4Cl2O2.C6H13N/c23-19(21-17-10-3-1-4-11-17)15-8-7-9-16(14-15)20(24)22-18-12-5-2-6-13-18;9-7(11)5-2-1-3-6(4-5)8(10)12;7-6-4-2-1-3-5-6/h7-9,14,17-18H,1-6,10-13H2,(H,21,23)(H,22,24);1-4H;6H,1-5,7H2 |
| InChIKey | ATSCENCYBHPKAD-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.66 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|