C13H27N5 — CID 142460688
2-N-butyl-6-N-[3-(dimethylamino)propyl]-1,2-dihydropyrimidine-2,6-diamine (PubChem CID 142460688) has the molecular formula C13H27N5 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-N-butyl-6-N-[3-(dimethylamino)propyl]-1,2-dihydropyrimidine-2,6-diamine.
| Compound Name | 2-N-butyl-6-N-[3-(dimethylamino)propyl]-1,2-dihydropyrimidine-2,6-diamine |
|---|---|
| PubChem CID | 142460688 |
| Molecular Formula | C13H27N5 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.23 |
| IUPAC Name | 2-N-butyl-6-N-[3-(dimethylamino)propyl]-1,2-dihydropyrimidine-2,6-diamine |
| SMILES | CCCCNC1N=CC=C(NCCCN(C)C)N1 |
| InChI | InChI=1S/C13H27N5/c1-4-5-8-15-13-16-10-7-12(17-13)14-9-6-11-18(2)3/h7,10,13-15,17H,4-6,8-9,11H2,1-3H3 |
| InChIKey | OHJZXCOZKGUYPL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 51.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|