C24H20 — CID 142461231
(13S,23R)-13-methylhexacyclo[15.5.1.02,14.03,12.04,9.020,23]tricosa-2(14),3(12),4,6,8,10,15,18,21-nonaene (PubChem CID 142461231) has the molecular formula C24H20 and a molecular weight of 308.42 g/mol. Its IUPAC name is (13S,23R)-13-methylhexacyclo[15.5.1.02,14.03,12.04,9.020,23]tricosa-2(14),3(12),4,6,8,10,15,18,21-nonaene.
| Compound Name | (13S,23R)-13-methylhexacyclo[15.5.1.02,14.03,12.04,9.020,23]tricosa-2(14),3(12),4,6,8,10,15,18,21-nonaene |
|---|---|
| PubChem CID | 142461231 |
| Molecular Formula | C24H20 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (13S,23R)-13-methylhexacyclo[15.5.1.02,14.03,12.04,9.020,23]tricosa-2(14),3(12),4,6,8,10,15,18,21-nonaene |
| SMILES | C[C@H]1C2=C(c3c1ccc1ccccc31)C1C=CC3C=CC(C=C2)[C@@H]31 |
| InChI | InChI=1S/C24H20/c1-14-18-11-8-15-4-2-3-5-20(15)23(18)24-19(14)12-9-16-6-7-17-10-13-21(24)22(16)17/h2-14,16-17,21-22H,1H3/t14-,16?,17?,21?,22+/m1/s1 |
| InChIKey | HCOVZFFUBMYMCS-AZXYQCSPSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|