C7H10F2O3 — CID 142463394
1-(difluoromethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 142463394) has the molecular formula C7H10F2O3 and a molecular weight of 180.15 g/mol. Its IUPAC name is 1-(difluoromethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | 1-(difluoromethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 142463394 |
| Molecular Formula | C7H10F2O3 |
| Molecular Weight | 180.15 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 1-(difluoromethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | OC1C=CCC(O)(C(F)F)C1O |
| InChI | InChI=1S/C7H10F2O3/c8-6(9)7(12)3-1-2-4(10)5(7)11/h1-2,4-6,10-12H,3H2 |
| InChIKey | ZQYOIIONXZWNNR-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.15 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|