C26H47N3O3 — CID 142465018
(2E,4Z)-N-[2-[cyclohexyl-[6-(methylamino)hexanoyl]amino]oxyethyl]-2-ethenyl-N-methylhexa-2,4-dienamide;ethane (PubChem CID 142465018) has the molecular formula C26H47N3O3 and a molecular weight of 449.68 g/mol. Its IUPAC name is (2E,4Z)-N-[2-[cyclohexyl-[6-(methylamino)hexanoyl]amino]oxyethyl]-2-ethenyl-N-methylhexa-2,4-dienamide;ethane.
| Compound Name | (2E,4Z)-N-[2-[cyclohexyl-[6-(methylamino)hexanoyl]amino]oxyethyl]-2-ethenyl-N-methylhexa-2,4-dienamide;ethane |
|---|---|
| PubChem CID | 142465018 |
| Molecular Formula | C26H47N3O3 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.36 |
| IUPAC Name | (2E,4Z)-N-[2-[cyclohexyl-[6-(methylamino)hexanoyl]amino]oxyethyl]-2-ethenyl-N-methylhexa-2,4-dienamide;ethane |
| SMILES | C=C/C(=C\C=C/C)C(=O)N(C)CCON(C(=O)CCCCCNC)C1CCCCC1.CC |
| InChI | InChI=1S/C24H41N3O3.C2H6/c1-5-7-14-21(6-2)24(29)26(4)19-20-30-27(22-15-10-8-11-16-22)23(28)17-12-9-13-18-25-3;1-2/h5-7,14,22,25H,2,8-13,15-20H2,1,3-4H3;1-2H3/b7-5-,21-14+; |
| InChIKey | ZHRNKPQJEAUQCN-CLPQEAAGSA-N |
| XLogP | 5.03 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|