C30H42N6O6 — CID 174167014
[3-[2-[cyclohexyl-[7-(pyridin-4-ylcarbamoylamino)heptanoyl]amino]oxyethyl-methylcarbamoyl]phenyl]carbamic acid (PubChem CID 174167014) has the molecular formula C30H42N6O6 and a molecular weight of 582.70 g/mol. Its IUPAC name is [3-[2-[cyclohexyl-[7-(pyridin-4-ylcarbamoylamino)heptanoyl]amino]oxyethyl-methylcarbamoyl]phenyl]carbamic acid.
| Compound Name | [3-[2-[cyclohexyl-[7-(pyridin-4-ylcarbamoylamino)heptanoyl]amino]oxyethyl-methylcarbamoyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 174167014 |
| Molecular Formula | C30H42N6O6 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | [3-[2-[cyclohexyl-[7-(pyridin-4-ylcarbamoylamino)heptanoyl]amino]oxyethyl-methylcarbamoyl]phenyl]carbamic acid |
| SMILES | CN(CCON(C(=O)CCCCCCNC(=O)Nc1ccncc1)C1CCCCC1)C(=O)c1cccc(NC(=O)O)c1 |
| InChI | InChI=1S/C30H42N6O6/c1-35(28(38)23-10-9-11-25(22-23)34-30(40)41)20-21-42-36(26-12-5-4-6-13-26)27(37)14-7-2-3-8-17-32-29(39)33-24-15-18-31-19-16-24/h9-11,15-16,18-19,22,26,34H,2-8,12-14,17,20-21H2,1H3,(H,40,41)(H2,31,32,33,39) |
| InChIKey | IFDHYFYISIGLNG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 153.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|