C11H18N2O2 — CID 142465624
4-(cyclohexylmethyl)-3-ethyl-1,2,4-oxadiazol-5-one (PubChem CID 142465624) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-3-ethyl-1,2,4-oxadiazol-5-one.
| Compound Name | 4-(cyclohexylmethyl)-3-ethyl-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 142465624 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-(cyclohexylmethyl)-3-ethyl-1,2,4-oxadiazol-5-one |
| SMILES | CCc1noc(=O)n1CC1CCCCC1 |
| InChI | InChI=1S/C11H18N2O2/c1-2-10-12-15-11(14)13(10)8-9-6-4-3-5-7-9/h9H,2-8H2,1H3 |
| InChIKey | LCKCDWYFLAMXEI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |