C11H18N2O2 — CID 166301466
3-cyclopropyl-4-hexyl-1,2,4-oxadiazol-5-one (PubChem CID 166301466) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-cyclopropyl-4-hexyl-1,2,4-oxadiazol-5-one.
| Compound Name | 3-cyclopropyl-4-hexyl-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 166301466 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-cyclopropyl-4-hexyl-1,2,4-oxadiazol-5-one |
| SMILES | CCCCCCn1c(C2CC2)noc1=O |
| InChI | InChI=1S/C11H18N2O2/c1-2-3-4-5-8-13-10(9-6-7-9)12-15-11(13)14/h9H,2-8H2,1H3 |
| InChIKey | VPKONGVYJPXTGL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|