About ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene
ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene (PubChem CID 142466560) has the molecular formula C29H41N
and a molecular weight of 403.65 g/mol. Its IUPAC name is ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene.
Molecular Properties
| Compound Name | ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene |
| PubChem CID | 142466560 |
| Molecular Formula | C29H41N |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.32 |
| IUPAC Name | ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene |
| SMILES | CC.CCCC(CCC)c1cc(C)cc(-c2ccccc2)n1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C19H25N.C8H10.C2H6/c1-4-9-16(10-5-2)18-13-15(3)14-19(20-18)17-11-7-6-8-12-17;1-7-4-3-5-8(2)6-7;1-2/h6-8,11-14,16H,4-5,9-10H2,1-3H3;3-6H,1-2H3;1-2H3 |
| InChIKey | OYWBVUKRTXUBKK-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene?
The IUPAC name of ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene (CID 142466560) is ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene.
What is the SMILES notation for ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene?
The canonical SMILES for ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene is CC.CCCC(CCC)c1cc(C)cc(-c2ccccc2)n1.Cc1cccc(C)c1.
What is the InChIKey of ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene?
The InChIKey is OYWBVUKRTXUBKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N.C8H10.C2H6/c1-4-9-16(10-5-2)18-13-15(3)14-19(20-18)17-11-7-6-8-12-17;1-7-4-3-5-8(2)6-7;1-2/h6-8,11-14,16H,4-5,9-10H2,1-3H3;3-6H,1-2H3;1-2H3.
What are the key properties of ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene?
ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene has a molecular weight of 403.65 g/mol, XLogP of 9.07, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-heptan-4-yl-4-methyl-6-phenylpyridine;1,3-xylene is sourced from PubChem (CID 142466560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).