C34H48N6OS — CID 142467424
ethane;N-piperidin-4-yl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 142467424) has the molecular formula C34H48N6OS and a molecular weight of 588.87 g/mol. Its IUPAC name is ethane;N-piperidin-4-yl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | ethane;N-piperidin-4-yl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 142467424 |
| Molecular Formula | C34H48N6OS |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | ethane;N-piperidin-4-yl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CC.CC.O=C(NC1CCNCC1)c1cc2ccc(-c3cc(NCCCN4CCCCC4)c4cnccc4n3)cc2s1 |
| InChI | InChI=1S/C30H36N6OS.2C2H6/c37-30(34-23-7-11-31-12-8-23)29-18-22-6-5-21(17-28(22)38-29)26-19-27(24-20-32-13-9-25(24)35-26)33-10-4-16-36-14-2-1-3-15-36;2*1-2/h5-6,9,13,17-20,23,31H,1-4,7-8,10-12,14-16H2,(H,33,35)(H,34,37);2*1-2H3 |
| InChIKey | LCLANDXFEDHQAD-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|