C10H21N3O2 — CID 142469236
(2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid (PubChem CID 142469236) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid.
| Compound Name | (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid |
|---|---|
| PubChem CID | 142469236 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid |
| SMILES | NC(CC[C@H](N)C(=O)O)N1CCCCC1 |
| InChI | InChI=1S/C10H21N3O2/c11-8(10(14)15)4-5-9(12)13-6-2-1-3-7-13/h8-9H,1-7,11-12H2,(H,14,15)/t8-,9?/m0/s1 |
| InChIKey | XREPDXVHCHTSGU-IENPIDJESA-N |
| XLogP | -0.05 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |