(2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid

C10H21N3O2 — CID 142469236

IUPAC(2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid
SMILESNC(CC[C@H](N)C(=O)O)N1CCCCC1
InChIInChI=1S/C10H21N3O2/c11-8(10(14)15)4-5-9(12)13-6-2-1-3-7-13/h8-9H,1-7,11-12H2,(H,14,15)/t8-,9?/m0/s1
InChIKeyXREPDXVHCHTSGU-IENPIDJESA-N
MW215.30 g/mol
LogP-0.05
Rot. Bonds5

About (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid

(2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid (PubChem CID 142469236) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid.

Molecular Properties

Compound Name(2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid
PubChem CID142469236
Molecular FormulaC10H21N3O2
Molecular Weight215.30 g/mol
Exact Mass215.16
IUPAC Name(2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid
SMILESNC(CC[C@H](N)C(=O)O)N1CCCCC1
InChIInChI=1S/C10H21N3O2/c11-8(10(14)15)4-5-9(12)13-6-2-1-3-7-13/h8-9H,1-7,11-12H2,(H,14,15)/t8-,9?/m0/s1
InChIKeyXREPDXVHCHTSGU-IENPIDJESA-N
XLogP-0.05
TPSA92.58 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.30
LogP ≤ 5-0.05
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid?
The IUPAC name of (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid (CID 142469236) is (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid.
What is the SMILES notation for (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid?
The canonical SMILES for (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid is NC(CC[C@H](N)C(=O)O)N1CCCCC1.
What is the InChIKey of (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid?
The InChIKey is XREPDXVHCHTSGU-IENPIDJESA-N. The full InChI is InChI=1S/C10H21N3O2/c11-8(10(14)15)4-5-9(12)13-6-2-1-3-7-13/h8-9H,1-7,11-12H2,(H,14,15)/t8-,9?/m0/s1.
What are the key properties of (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid?
(2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid has a molecular weight of 215.30 g/mol, XLogP of -0.05, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,5-diamino-5-piperidin-1-ylpentanoic acid is sourced from PubChem (CID 142469236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).