C17H32N4O5 — CID 174933136
6-(azepan-1-yl)-6-oxohexanamide;2,5-diamino-5-oxopentanoic acid (PubChem CID 174933136) has the molecular formula C17H32N4O5 and a molecular weight of 372.47 g/mol. Its IUPAC name is 6-(azepan-1-yl)-6-oxohexanamide;2,5-diamino-5-oxopentanoic acid.
| Compound Name | 6-(azepan-1-yl)-6-oxohexanamide;2,5-diamino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174933136 |
| Molecular Formula | C17H32N4O5 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 6-(azepan-1-yl)-6-oxohexanamide;2,5-diamino-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)O.NC(=O)CCCCC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H22N2O2.C5H10N2O3/c13-11(15)7-3-4-8-12(16)14-9-5-1-2-6-10-14;6-3(5(9)10)1-2-4(7)8/h1-10H2,(H2,13,15);3H,1-2,6H2,(H2,7,8)(H,9,10) |
| InChIKey | FSZHZGWAMXDUGD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 169.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|