C24H33NO4 — CID 142470201
formaldehyde;1-methoxy-4-methylbenzene;3-[2-(3-methoxyphenyl)ethyl]azepan-2-one (PubChem CID 142470201) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is formaldehyde;1-methoxy-4-methylbenzene;3-[2-(3-methoxyphenyl)ethyl]azepan-2-one.
| Compound Name | formaldehyde;1-methoxy-4-methylbenzene;3-[2-(3-methoxyphenyl)ethyl]azepan-2-one |
|---|---|
| PubChem CID | 142470201 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | formaldehyde;1-methoxy-4-methylbenzene;3-[2-(3-methoxyphenyl)ethyl]azepan-2-one |
| SMILES | C=O.COc1ccc(C)cc1.COc1cccc(CCC2CCCCNC2=O)c1 |
| InChI | InChI=1S/C15H21NO2.C8H10O.CH2O/c1-18-14-7-4-5-12(11-14)8-9-13-6-2-3-10-16-15(13)17;1-7-3-5-8(9-2)6-4-7;1-2/h4-5,7,11,13H,2-3,6,8-10H2,1H3,(H,16,17);3-6H,1-2H3;1H2 |
| InChIKey | OXADMGKNCIHXNL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |