C7H14N4O3 — CID 142470512
N-(2-formamidoethyl)-2-(methyliminomethylamino)oxyacetamide (PubChem CID 142470512) has the molecular formula C7H14N4O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is N-(2-formamidoethyl)-2-(methyliminomethylamino)oxyacetamide.
| Compound Name | N-(2-formamidoethyl)-2-(methyliminomethylamino)oxyacetamide |
|---|---|
| PubChem CID | 142470512 |
| Molecular Formula | C7H14N4O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-(2-formamidoethyl)-2-(methyliminomethylamino)oxyacetamide |
| SMILES | C/N=C/NOCC(=O)NCCNC=O |
| InChI | InChI=1S/C7H14N4O3/c1-8-5-11-14-4-7(13)10-3-2-9-6-12/h5-6H,2-4H2,1H3,(H,8,11)(H,9,12)(H,10,13) |
| InChIKey | FSENOUVLIBKVGY-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|