C7H14N4O4 — CID 175942275
2-[[2-(methyliminomethylamino)oxyacetyl]amino]ethyl carbamate (PubChem CID 175942275) has the molecular formula C7H14N4O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-[[2-(methyliminomethylamino)oxyacetyl]amino]ethyl carbamate.
| Compound Name | 2-[[2-(methyliminomethylamino)oxyacetyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 175942275 |
| Molecular Formula | C7H14N4O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 2-[[2-(methyliminomethylamino)oxyacetyl]amino]ethyl carbamate |
| SMILES | C/N=C/NOCC(=O)NCCOC(N)=O |
| InChI | InChI=1S/C7H14N4O4/c1-9-5-11-15-4-6(12)10-2-3-14-7(8)13/h5H,2-4H2,1H3,(H2,8,13)(H,9,11)(H,10,12) |
| InChIKey | GBMUEKGFVZTSOY-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|