C26H26F2N4O4 — CID 142470889
N-(2,2-difluoroethyl)-3-[4-[2-[4-[(2-hydroxyethylamino)methyl]phenyl]ethynyl]phenyl]-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)propanamide (PubChem CID 142470889) has the molecular formula C26H26F2N4O4 and a molecular weight of 496.51 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-[4-[2-[4-[(2-hydroxyethylamino)methyl]phenyl]ethynyl]phenyl]-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)propanamide.
| Compound Name | N-(2,2-difluoroethyl)-3-[4-[2-[4-[(2-hydroxyethylamino)methyl]phenyl]ethynyl]phenyl]-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)propanamide |
|---|---|
| PubChem CID | 142470889 |
| Molecular Formula | C26H26F2N4O4 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-[4-[2-[4-[(2-hydroxyethylamino)methyl]phenyl]ethynyl]phenyl]-2-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)propanamide |
| SMILES | O=C(NCC(F)F)C(Cc1ccc(C#Cc2ccc(CNCCO)cc2)cc1)c1nc[nH]c(=O)c1O |
| InChI | InChI=1S/C26H26F2N4O4/c27-22(28)15-30-25(35)21(23-24(34)26(36)32-16-31-23)13-19-7-3-17(4-8-19)1-2-18-5-9-20(10-6-18)14-29-11-12-33/h3-10,16,21-22,29,33-34H,11-15H2,(H,30,35)(H,31,32,36) |
| InChIKey | PCJUOXDMPUUZEC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|