C32H29FN4O5 — CID 142471628
N-benzyl-N-[(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]naphthalene-2-carboxamide (PubChem CID 142471628) has the molecular formula C32H29FN4O5 and a molecular weight of 568.61 g/mol. Its IUPAC name is N-benzyl-N-[(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-benzyl-N-[(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 142471628 |
| Molecular Formula | C32H29FN4O5 |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | N-benzyl-N-[(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]naphthalene-2-carboxamide |
| SMILES | O=C(c1ccc2ccccc2c1)N(Cc1ccccc1)[C@@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3cccc(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C32H29FN4O5/c33-25-12-6-11-23(16-25)26-18-37(35-34-26)28-29(39)27(19-38)42-32(30(28)40)36(17-20-7-2-1-3-8-20)31(41)24-14-13-21-9-4-5-10-22(21)15-24/h1-16,18,27-30,32,38-40H,17,19H2/t27-,28+,29+,30-,32-/m1/s1 |
| InChIKey | QNRRURDXCJGXDB-UAHJUHPCSA-N |
| XLogP | 3.56 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |