C25H25FN4O7 — CID 159306848
1-benzyl-3-[(2S,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrrolidine-2,5-dione (PubChem CID 159306848) has the molecular formula C25H25FN4O7 and a molecular weight of 512.49 g/mol. Its IUPAC name is 1-benzyl-3-[(2S,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrrolidine-2,5-dione.
| Compound Name | 1-benzyl-3-[(2S,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 159306848 |
| Molecular Formula | C25H25FN4O7 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 1-benzyl-3-[(2S,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrrolidine-2,5-dione |
| SMILES | O=C1CC(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4cccc(F)c4)nn3)[C@H]2O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H25FN4O7/c26-16-8-4-7-15(9-16)17-12-30(28-27-17)21-22(33)19(13-31)37-25(23(21)34)36-18-10-20(32)29(24(18)35)11-14-5-2-1-3-6-14/h1-9,12,18-19,21-23,25,31,33-34H,10-11,13H2/t18?,19-,21+,22+,23-,25-/m1/s1 |
| InChIKey | LCAGUICIHIQSQN-DRAOLWNLSA-N |
| XLogP | 0.41 |
| TPSA | 147.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|