C29H32F2N6O7S — CID 159878047
(2R,5R)-2-ethyl-4-[4-(3-fluorophenyl)triazol-1-yl]-6-[(2S,4S,5R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyloxane-3,5-diol (PubChem CID 159878047) has the molecular formula C29H32F2N6O7S and a molecular weight of 646.67 g/mol. Its IUPAC name is (2R,5R)-2-ethyl-4-[4-(3-fluorophenyl)triazol-1-yl]-6-[(2S,4S,5R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyloxane-3,5-diol.
| Compound Name | (2R,5R)-2-ethyl-4-[4-(3-fluorophenyl)triazol-1-yl]-6-[(2S,4S,5R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyloxane-3,5-diol |
|---|---|
| PubChem CID | 159878047 |
| Molecular Formula | C29H32F2N6O7S |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | (2R,5R)-2-ethyl-4-[4-(3-fluorophenyl)triazol-1-yl]-6-[(2S,4S,5R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyloxane-3,5-diol |
| SMILES | CC[C@H]1OC(S[C@@H]2OC(CO)[C@H](O)[C@H](n3cc(-c4cccc(F)c4)nn3)C2O)[C@H](O)C(n2cc(-c3cccc(F)c3)nn2)C1O |
| InChI | InChI=1S/C29H32F2N6O7S/c1-2-20-24(39)22(36-11-18(32-34-36)14-5-3-7-16(30)9-14)26(41)28(43-20)45-29-27(42)23(25(40)21(13-38)44-29)37-12-19(33-35-37)15-6-4-8-17(31)10-15/h3-12,20-29,38-42H,2,13H2,1H3/t20-,21?,22?,23+,24?,25+,26-,27?,28?,29+/m1/s1 |
| InChIKey | NTDXGJKCDHTYLR-PEIBGDJKSA-N |
| XLogP | 1.29 |
| TPSA | 181.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |