C13H14FN3O4S — CID 146605337
(5R)-4-[4-(3-fluorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxathiane-3,5-diol (PubChem CID 146605337) has the molecular formula C13H14FN3O4S and a molecular weight of 327.34 g/mol. Its IUPAC name is (5R)-4-[4-(3-fluorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxathiane-3,5-diol.
| Compound Name | (5R)-4-[4-(3-fluorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxathiane-3,5-diol |
|---|---|
| PubChem CID | 146605337 |
| Molecular Formula | C13H14FN3O4S |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | (5R)-4-[4-(3-fluorophenyl)triazol-1-yl]-6-(hydroxymethyl)oxathiane-3,5-diol |
| SMILES | OCC1OSC(O)C(n2cc(-c3cccc(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C13H14FN3O4S/c14-8-3-1-2-7(4-8)9-5-17(16-15-9)11-12(19)10(6-18)21-22-13(11)20/h1-5,10-13,18-20H,6H2/t10?,11?,12-,13?/m0/s1 |
| InChIKey | PNIYQSUJQUAVIR-ARAJFMJPSA-N |
| XLogP | 0.34 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|