C19H19FN4O7 — CID 138505952
2-[(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-methyl-1,3-oxazole-5-carboxylic acid (PubChem CID 138505952) has the molecular formula C19H19FN4O7 and a molecular weight of 434.38 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-methyl-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-methyl-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 138505952 |
| Molecular Formula | C19H19FN4O7 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-4-methyl-1,3-oxazole-5-carboxylic acid |
| SMILES | Cc1nc([C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4cccc(F)c4)nn3)[C@H]2O)oc1C(=O)O |
| InChI | InChI=1S/C19H19FN4O7/c1-8-16(19(28)29)31-18(21-8)17-15(27)13(14(26)12(7-25)30-17)24-6-11(22-23-24)9-3-2-4-10(20)5-9/h2-6,12-15,17,25-27H,7H2,1H3,(H,28,29)/t12-,13+,14+,15-,17-/m1/s1 |
| InChIKey | PBKPMMOAMFJWFT-RUCLQGLUSA-N |
| XLogP | 0.47 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |