C25H30FN5O6 — CID 155201806
(2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)-N-[2-(4-methoxy-N-methylanilino)ethyl]oxane-2-carboxamide (PubChem CID 155201806) has the molecular formula C25H30FN5O6 and a molecular weight of 515.54 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)-N-[2-(4-methoxy-N-methylanilino)ethyl]oxane-2-carboxamide.
| Compound Name | (2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)-N-[2-(4-methoxy-N-methylanilino)ethyl]oxane-2-carboxamide |
|---|---|
| PubChem CID | 155201806 |
| Molecular Formula | C25H30FN5O6 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | (2R,3R,4S,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)-N-[2-(4-methoxy-N-methylanilino)ethyl]oxane-2-carboxamide |
| SMILES | COc1ccc(N(C)CCNC(=O)[C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4cccc(F)c4)nn3)[C@H]2O)cc1 |
| InChI | InChI=1S/C25H30FN5O6/c1-30(17-6-8-18(36-2)9-7-17)11-10-27-25(35)24-23(34)21(22(33)20(14-32)37-24)31-13-19(28-29-31)15-4-3-5-16(26)12-15/h3-9,12-13,20-24,32-34H,10-11,14H2,1-2H3,(H,27,35)/t20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | AUPXKQLEDVNBQV-OYTPZHDJSA-N |
| XLogP | 0.37 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|