C26H32FN5O6 — CID 155201795
2-[(2S,3R,4R,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-N-[2-(4-methoxyanilino)ethyl]-N-methylacetamide (PubChem CID 155201795) has the molecular formula C26H32FN5O6 and a molecular weight of 529.57 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-N-[2-(4-methoxyanilino)ethyl]-N-methylacetamide.
| Compound Name | 2-[(2S,3R,4R,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-N-[2-(4-methoxyanilino)ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 155201795 |
| Molecular Formula | C26H32FN5O6 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 2-[(2S,3R,4R,5R,6R)-4-[4-(3-fluorophenyl)triazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-N-[2-(4-methoxyanilino)ethyl]-N-methylacetamide |
| SMILES | COc1ccc(NCCN(C)C(=O)C[C@@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4cccc(F)c4)nn3)[C@H]2O)cc1 |
| InChI | InChI=1S/C26H32FN5O6/c1-31(11-10-28-18-6-8-19(37-2)9-7-18)23(34)13-21-25(35)24(26(36)22(15-33)38-21)32-14-20(29-30-32)16-4-3-5-17(27)12-16/h3-9,12,14,21-22,24-26,28,33,35-36H,10-11,13,15H2,1-2H3/t21-,22+,24+,25-,26-/m0/s1 |
| InChIKey | DWHKXMFHTDXKAL-AUOTXKHZSA-N |
| XLogP | 1.08 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|