C11H20O3S — CID 142472594
ethane;(2E)-2-methylsulfanyl-3-propoxypenta-2,4-dienoic acid (PubChem CID 142472594) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is ethane;(2E)-2-methylsulfanyl-3-propoxypenta-2,4-dienoic acid.
| Compound Name | ethane;(2E)-2-methylsulfanyl-3-propoxypenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 142472594 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | ethane;(2E)-2-methylsulfanyl-3-propoxypenta-2,4-dienoic acid |
| SMILES | C=C/C(OCCC)=C(\SC)C(=O)O.CC |
| InChI | InChI=1S/C9H14O3S.C2H6/c1-4-6-12-7(5-2)8(13-3)9(10)11;1-2/h5H,2,4,6H2,1,3H3,(H,10,11);1-2H3/b8-7+; |
| InChIKey | VLKJJRJWLPLBGC-USRGLUTNSA-N |
| XLogP | 3.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|