C26H32N4O3S — CID 142474694
N-[4-(tert-butylamino)sulfanylphenyl]-3-(4-methoxyphenyl)propanamide;pyridine-3-carboxamide (PubChem CID 142474694) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is N-[4-(tert-butylamino)sulfanylphenyl]-3-(4-methoxyphenyl)propanamide;pyridine-3-carboxamide.
| Compound Name | N-[4-(tert-butylamino)sulfanylphenyl]-3-(4-methoxyphenyl)propanamide;pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142474694 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | N-[4-(tert-butylamino)sulfanylphenyl]-3-(4-methoxyphenyl)propanamide;pyridine-3-carboxamide |
| SMILES | COc1ccc(CCC(=O)Nc2ccc(SNC(C)(C)C)cc2)cc1.NC(=O)c1cccnc1 |
| InChI | InChI=1S/C20H26N2O2S.C6H6N2O/c1-20(2,3)22-25-18-12-8-16(9-13-18)21-19(23)14-7-15-5-10-17(24-4)11-6-15;7-6(9)5-2-1-3-8-4-5/h5-6,8-13,22H,7,14H2,1-4H3,(H,21,23);1-4H,(H2,7,9) |
| InChIKey | WLDQJFRKANPTHC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|