C26H31N3O2S — CID 142474770
benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide (PubChem CID 142474770) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide.
| Compound Name | benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 142474770 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide |
| SMILES | CC(C)(C)NSc1ccc(NC(=O)CCc2ccccc2)cc1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24N2OS.C7H7NO/c1-19(2,3)21-23-17-12-10-16(11-13-17)20-18(22)14-9-15-7-5-4-6-8-15;8-7(9)6-4-2-1-3-5-6/h4-8,10-13,21H,9,14H2,1-3H3,(H,20,22);1-5H,(H2,8,9) |
| InChIKey | NXQVSPWBTZANAZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|