About benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide
benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide (PubChem CID 142474770) has the molecular formula C26H31N3O2S
and a molecular weight of 449.62 g/mol. Its IUPAC name is benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide.
Molecular Properties
| Compound Name | benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide |
| PubChem CID | 142474770 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide |
| SMILES | CC(C)(C)NSc1ccc(NC(=O)CCc2ccccc2)cc1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24N2OS.C7H7NO/c1-19(2,3)21-23-17-12-10-16(11-13-17)20-18(22)14-9-15-7-5-4-6-8-15;8-7(9)6-4-2-1-3-5-6/h4-8,10-13,21H,9,14H2,1-3H3,(H,20,22);1-5H,(H2,8,9) |
| InChIKey | NXQVSPWBTZANAZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide?
The IUPAC name of benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide (CID 142474770) is benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide.
What is the SMILES notation for benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide?
The canonical SMILES for benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide is CC(C)(C)NSc1ccc(NC(=O)CCc2ccccc2)cc1.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide?
The InChIKey is NXQVSPWBTZANAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2OS.C7H7NO/c1-19(2,3)21-23-17-12-10-16(11-13-17)20-18(22)14-9-15-7-5-4-6-8-15;8-7(9)6-4-2-1-3-5-6/h4-8,10-13,21H,9,14H2,1-3H3,(H,20,22);1-5H,(H2,8,9).
What are the key properties of benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide?
benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide has a molecular weight of 449.62 g/mol, XLogP of 5.44, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;N-[4-(tert-butylamino)sulfanylphenyl]-3-phenylpropanamide is sourced from PubChem (CID 142474770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).