C22H22FN3O2S — CID 142474701
N-(4-aminosulfanylphenyl)-3-(4-fluorophenyl)propanamide;benzamide (PubChem CID 142474701) has the molecular formula C22H22FN3O2S and a molecular weight of 411.50 g/mol. Its IUPAC name is N-(4-aminosulfanylphenyl)-3-(4-fluorophenyl)propanamide;benzamide.
| Compound Name | N-(4-aminosulfanylphenyl)-3-(4-fluorophenyl)propanamide;benzamide |
|---|---|
| PubChem CID | 142474701 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-(4-aminosulfanylphenyl)-3-(4-fluorophenyl)propanamide;benzamide |
| SMILES | NC(=O)c1ccccc1.NSc1ccc(NC(=O)CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H15FN2OS.C7H7NO/c16-12-4-1-11(2-5-12)3-10-15(19)18-13-6-8-14(20-17)9-7-13;8-7(9)6-4-2-1-3-5-6/h1-2,4-9H,3,10,17H2,(H,18,19);1-5H,(H2,8,9) |
| InChIKey | ZHWGIKFEKNCAND-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|